6587-24-2 methyl 2-cyanobenzoate
Produkt-Name |
methyl 2-cyanobenzoate |
Englischer Name |
methyl 2-cyanobenzoate; |
Molekulare Formel |
C9H7NO2 |
Molecular Weight |
161.1574 |
InChI |
InChI=1/C9H7NO2/c1-12-9(11)8-5-3-2-4-7(8)6-10/h2-5H,1H3 |
CAS Registry Number |
6587-24-2 |
Molecular Structure |
|
Dichte |
1.18g/cm3 |
Schmelzpunkt |
47℃ |
Siedepunkt |
295.8°C at 760 mmHg |
Brechungsindex |
1.535 |
Flammpunkt |
136.2°C |
Dampfdruck |
0.00149mmHg at 25°C |
Gefahrensymbole |
Xn:Harmful;
|
Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Safety Beschreibung |
S36/37:Wear suitable protective clothing and gloves.;
|
|