659-30-3 4-fluorophenylurea
Produkt-Name |
4-fluorophenylurea |
Englischer Name |
4-fluorophenylurea;Urea, 1-(p-fluorophenyl)-; (4-Fluorophenyl)urea; 1-(p-Fluorophenyl)urea; 4-12-00-01108 (Beilstein Handbook Reference); BRN 2090131; 1-(4-fluorophenyl)urea; 1-(4-fluorophenyl)-1H-pyrrole |
Molekulare Formel |
C10H8FN |
Molecular Weight |
161.1756 |
InChI |
InChI=1/C10H8FN/c11-9-3-5-10(6-4-9)12-7-1-2-8-12/h1-8H |
CAS Registry Number |
659-30-3 |
Molecular Structure |
|
Dichte |
1.07g/cm3 |
Siedepunkt |
229.7°C at 760 mmHg |
Brechungsindex |
1.543 |
Flammpunkt |
92.7°C |
Dampfdruck |
0.104mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|