ChemNet > CAS > 668-94-0 4,5-Diphenylimidazole
668-94-0 4,5-Diphenylimidazole
| Produkt-Name |
4,5-Diphenylimidazole |
| Englischer Name |
4,5-Diphenylimidazole;4,5-Diphenyl-1H-imidazole; NSC 59776; 1H-Imidazole, 4,5-diphenyl- (9CI); Imidazole, 4,5-diphenyl- (8CI) |
| Molekulare Formel |
C15H12N2 |
| Molecular Weight |
220.2692 |
| InChI |
InChI=1/C15H12N2/c1-3-7-12(8-4-1)14-15(17-11-16-14)13-9-5-2-6-10-13/h1-11H,(H,16,17) |
| CAS Registry Number |
668-94-0 |
| EINECS |
211-573-3 |
| Molecular Structure |
|
| Dichte |
1.149g/cm3 |
| Schmelzpunkt |
229-233℃ |
| Siedepunkt |
423.4°C at 760 mmHg |
| Brechungsindex |
1.627 |
| Flammpunkt |
223.7°C |
| Dampfdruck |
5.51E-07mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
