ChemNet > CAS > 67762-39-4 Fettsäuren, C6-12, Me-Ester
67762-39-4 Fettsäuren, C6-12, Me-Ester
| Produkt-Name |
Fettsäuren, C6-12, Me-Ester |
| Synonyme |
(C6-C12) Alkylcarbonsäuremethylester; C6-12-Fettsäuremethylester; Caswell: Nein.568C; EPA Pesticide Chemical Code 079034; Fettsäuren, Methylester; Methyloctanoat und Methyldecanoat; Ableger O; Octansäure, Methylester gemischt mit Methyldecanoat; Methylester von Speisefettsäuren (C8-C12) |
| Englischer Name |
Fatty acids, C6-12, Me esters;(C6-C12) Alkylcarboxylic acid methyl ester; C6-12-Fatty acids methyl esters; Caswell No. 568C; EPA Pesticide Chemical Code 079034; Fatty acids, methyl esters; Methyl octanoate and methyl decanoate; Off-Shoot O; Octanoic acid, methyl ester mixed with methyl decanoate; Methyl esters of fatty acids (C8-C12) |
| Molekulare Formel |
C9H18O2 |
| Molecular Weight |
158.238 |
| InChI |
InChI=1/C9H18O2/c1-3-4-5-6-7-8-9(10)11-2/h3-8H2,1-2H3 |
| CAS Registry Number |
67762-39-4 |
| EINECS |
267-017-5 |
| Molecular Structure |
|
| Dichte |
0.876g/cm3 |
| Siedepunkt |
191.1°C at 760 mmHg |
| Brechungsindex |
1.418 |
| Flammpunkt |
72.8°C |
| Dampfdruck |
0.523mmHg at 25°C |
|