ChemNet > CAS > 68515-50-4 1,2-Benzenedicarboxylic acid, dihexyl ester, branched and linear
68515-50-4 1,2-Benzenedicarboxylic acid, dihexyl ester, branched and linear
| Produkt-Name |
1,2-Benzenedicarboxylic acid, dihexyl ester, branched and linear |
| Englischer Name |
1,2-Benzenedicarboxylic acid, dihexyl ester, branched and linear;Branched and linear dihexyl phthalate; bis(4-methylpentyl) benzene-1,2-dicarboxylate |
| Molekulare Formel |
C20H30O4 |
| Molecular Weight |
334.4498 |
| InChI |
InChI=1/C20H30O4/c1-15(2)9-7-13-23-19(21)17-11-5-6-12-18(17)20(22)24-14-8-10-16(3)4/h5-6,11-12,15-16H,7-10,13-14H2,1-4H3 |
| CAS Registry Number |
68515-50-4 |
| EINECS |
271-093-5 |
| Molecular Structure |
|
| Dichte |
1.01g/cm3 |
| Siedepunkt |
341.5°C at 760 mmHg |
| Brechungsindex |
1.492 |
| Flammpunkt |
180°C |
| Dampfdruck |
8.01E-05mmHg at 25°C |
|