ChemNet > CAS > 69321-60-4 2,6-Dibromotoluene
69321-60-4 2,6-Dibromotoluene
| Produkt-Name |
2,6-Dibromotoluene |
| Englischer Name |
2,6-Dibromotoluene; 1,3-dibromo-2-methylbenzene |
| Molekulare Formel |
C7H6Br2 |
| Molecular Weight |
249.9305 |
| InChI |
InChI=1/C7H6Br2/c1-5-6(8)3-2-4-7(5)9/h2-4H,1H3 |
| CAS Registry Number |
69321-60-4 |
| Molecular Structure |
|
| Dichte |
1.81g/cm3 |
| Siedepunkt |
246°C at 760 mmHg |
| Brechungsindex |
1.587 |
| Flammpunkt |
106.6°C |
| Dampfdruck |
0.0436mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
R36/38:Irritating to eyes and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
