6937-34-4 3-iodophthalic acid
Produkt-Name |
3-iodophthalic acid |
Englischer Name |
3-iodophthalic acid; 3-iodobenzene-1,2-dicarboxylic acid; 3-Iodophthaltc acid |
Molekulare Formel |
C8H5IO4 |
Molecular Weight |
292.0274 |
InChI |
InChI=1/C8H5IO4/c9-5-3-1-2-4(7(10)11)6(5)8(12)13/h1-3H,(H,10,11)(H,12,13) |
CAS Registry Number |
6937-34-4 |
Molecular Structure |
|
Dichte |
2.138g/cm3 |
Schmelzpunkt |
232℃ |
Siedepunkt |
426.3°C at 760 mmHg |
Brechungsindex |
1.704 |
Flammpunkt |
211.6°C |
Dampfdruck |
5.01E-08mmHg at 25°C |
Gefahrensymbole |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|