ChemNet > CAS > 69687-80-5 methyl 2,5-dimethyl-1H-pyrrole-3-carboxylate
69687-80-5 methyl 2,5-dimethyl-1H-pyrrole-3-carboxylate
| Produkt-Name |
methyl 2,5-dimethyl-1H-pyrrole-3-carboxylate |
| Englischer Name |
methyl 2,5-dimethyl-1H-pyrrole-3-carboxylate; Methyl 2,5-dimethylpyrrole-3-carboxylate |
| Molekulare Formel |
C8H11NO2 |
| Molecular Weight |
153.1784 |
| InChI |
InChI=1/C8H11NO2/c1-5-4-7(6(2)9-5)8(10)11-3/h4,9H,1-3H3 |
| CAS Registry Number |
69687-80-5 |
| Molecular Structure |
|
| Dichte |
1.108g/cm3 |
| Schmelzpunkt |
115℃ |
| Siedepunkt |
294.3°C at 760 mmHg |
| Brechungsindex |
1.521 |
| Flammpunkt |
131.8°C |
| Dampfdruck |
0.00163mmHg at 25°C |
| Gefahrensymbole |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
