ChemNet > CAS > 69778-83-2 4-Methoxy-3-pyrrolin-2-one
69778-83-2 4-Methoxy-3-pyrrolin-2-one
| Produkt-Name |
4-Methoxy-3-pyrrolin-2-one |
| Englischer Name |
4-Methoxy-3-pyrrolin-2-one; 1,5-Dihydro-4-methoxy-2H-pyrrol-2-on; 4-methoxy-1,5-dihydro-2H-pyrrol-2-one |
| Molekulare Formel |
C5H7NO2 |
| Molecular Weight |
113.1146 |
| InChI |
InChI=1/C5H7NO2/c1-8-4-2-5(7)6-3-4/h2H,3H2,1H3,(H,6,7) |
| CAS Registry Number |
69778-83-2 |
| Molecular Structure |
|
| Dichte |
1.16g/cm3 |
| Schmelzpunkt |
130-133℃ |
| Siedepunkt |
349.6°C at 760 mmHg |
| Brechungsindex |
1.495 |
| Flammpunkt |
165.2°C |
| Dampfdruck |
4.65E-05mmHg at 25°C |
| Gefahrensymbole |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
