ChemNet > CAS > 698-76-0 Octanolactone
698-76-0 Octanolactone
| Produkt-Name |
Octanolactone |
| Englischer Name |
Octanolactone; 5-Hydroxyoctanoic acid lactone; delta-Octalactone; 1,5-Octanolide; 6-propyltetrahydro-2H-pyran-2-one; Delta Octalactone |
| Molekulare Formel |
C8H14O2 |
| Molecular Weight |
142.1956 |
| InChI |
InChI=1/C8H14O2/c1-2-4-7-5-3-6-8(9)10-7/h7H,2-6H2,1H3 |
| CAS Registry Number |
698-76-0 |
| EINECS |
211-820-5 |
| Molecular Structure |
|
| Dichte |
0.96g/cm3 |
| Siedepunkt |
239.8°C at 760 mmHg |
| Brechungsindex |
1.436 |
| Flammpunkt |
92.2°C |
| Dampfdruck |
0.0394mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
R36/38:Irritating to eyes and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
