ChemNet > CAS > 70729-87-2 Isooctadecansäure, Verbindung mit N,N-Dimethyldodecylamin (1:1)
70729-87-2 Isooctadecansäure, Verbindung mit N,N-Dimethyldodecylamin (1:1)
| Produkt-Name |
Isooctadecansäure, Verbindung mit N,N-Dimethyldodecylamin (1:1) |
| Synonyme |
Dimethyllauraminisostearat; Dimethyllaurylaminisostearat; Dimethyllaurylaminisostearat; Isooctadecansäure, komp.mit N,N-Dimethyl-1-dodecanamin (1:1); Isooctadecansäure, Verbindung mit N,N-Dimethyldodecylamin (1:1); 16-Methylheptadecansäure - N,N-Dimethyldodecan-1-amin (1:1) |
| Englischer Name |
isooctadecanoic acid, compound with N,N-dimethyldodecylamine (1:1);Dimethyl lauramine isostearate; Dimethyl laurylamine isostearate; Dimethyllaurylamine isostearate; Isooctadecanoic acid, compd. with N,N-dimethyl-1-dodecanamine (1:1); Isooctadecanoic acid, compound with N,N-dimethyldodecylamine (1:1); 16-methylheptadecanoic acid - N,N-dimethyldodecan-1-amine (1:1) |
| Molekulare Formel |
C32H67NO2 |
| Molecular Weight |
497.8799 |
| InChI |
InChI=1/C18H36O2.C14H31N/c1-17(2)15-13-11-9-7-5-3-4-6-8-10-12-14-16-18(19)20;1-4-5-6-7-8-9-10-11-12-13-14-15(2)3/h17H,3-16H2,1-2H3,(H,19,20);4-14H2,1-3H3 |
| CAS Registry Number |
70729-87-2 |
| EINECS |
274-834-0 |
| Molecular Structure |
|
| Siedepunkt |
400.8°C at 760 mmHg |
| Flammpunkt |
225.6°C |
| Dampfdruck |
1.52E-07mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
|
|
