ChemNet > CAS > 7073-36-1 2-Chloro-4-nitrobenzoyl chloride
7073-36-1 2-Chloro-4-nitrobenzoyl chloride
| Produkt-Name |
2-Chloro-4-nitrobenzoyl chloride |
| Englischer Name |
2-Chloro-4-nitrobenzoyl chloride;Benzoyl chloride, 2-chloro-4-nitro- |
| Molekulare Formel |
C7H3Cl2NO3 |
| Molecular Weight |
220.0096 |
| InChI |
InChI=1/C7H3Cl2NO3/c8-6-3-4(10(12)13)1-2-5(6)7(9)11/h1-3H |
| CAS Registry Number |
7073-36-1 |
| EINECS |
230-367-4 |
| Molecular Structure |
|
| Dichte |
1.575g/cm3 |
| Siedepunkt |
299.2°C at 760 mmHg |
| Brechungsindex |
1.602 |
| Flammpunkt |
134.7°C |
| Dampfdruck |
0.00121mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
