720-44-5 4-Methoxybenzhydrol
Produkt-Name |
4-Methoxybenzhydrol |
Englischer Name |
4-Methoxybenzhydrol; 4-Methoxydiphenylmethanol~4-Methoxyphenyl phenyl carbinol; (4-methoxyphenyl)(phenyl)methanol |
Molekulare Formel |
C14H14O2 |
Molecular Weight |
214.2598 |
InChI |
InChI=1/C14H14O2/c1-16-13-9-7-12(8-10-13)14(15)11-5-3-2-4-6-11/h2-10,14-15H,1H3 |
CAS Registry Number |
720-44-5 |
EINECS |
211-953-9 |
Molecular Structure |
|
Dichte |
1.121g/cm3 |
Siedepunkt |
363.2°C at 760 mmHg |
Brechungsindex |
1.582 |
Flammpunkt |
164.5°C |
Dampfdruck |
6.55E-06mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|