ChemNet > CAS > 7210-77-7 Ethyl 2,4-dimethylthiazole-5-carboxylate
7210-77-7 Ethyl 2,4-dimethylthiazole-5-carboxylate
Produkt-Name |
Ethyl 2,4-dimethylthiazole-5-carboxylate |
Englischer Name |
Ethyl 2,4-dimethylthiazole-5-carboxylate;ethyl 2,4-dimethyl-1,3-thiazole-5-carboxylate |
Molekulare Formel |
C8H11NO2S |
Molecular Weight |
185.2434 |
InChI |
InChI=1/C8H11NO2S/c1-4-11-8(10)7-5(2)9-6(3)12-7/h4H2,1-3H3 |
CAS Registry Number |
7210-77-7 |
Molecular Structure |
|
Dichte |
1.164g/cm3 |
Schmelzpunkt |
48℃ |
Siedepunkt |
254.341°C at 760 mmHg |
Brechungsindex |
1.525 |
Flammpunkt |
107.622°C |
Dampfdruck |
0.017mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|