ChemNet > CAS > 723-89-7 1-phenylisatin
723-89-7 1-phenylisatin
| Produkt-Name |
1-phenylisatin |
| Englischer Name |
1-phenylisatin;1H-Indole-2,3-dione, 1-phenyl- (9CI); 1-Phenyl-1H-indole-2,3-dione; 1-Phenyl-indole-2,3-dione; 1-Phenylisatin; 5-21-10-00247 (Beilstein Handbook Reference); BRN 0164531; NSC 100013; Indole-2,3-dione, 1-phenyl- |
| Molekulare Formel |
C14H9NO2 |
| Molecular Weight |
223.2268 |
| InChI |
InChI=1/C14H9NO2/c16-13-11-8-4-5-9-12(11)15(14(13)17)10-6-2-1-3-7-10/h1-9H |
| CAS Registry Number |
723-89-7 |
| Molecular Structure |
|
| Dichte |
1.338g/cm3 |
| Schmelzpunkt |
138-140℃ |
| Siedepunkt |
388.8°C at 760 mmHg |
| Brechungsindex |
1.667 |
| Flammpunkt |
182.6°C |
| Dampfdruck |
2.99E-06mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
