ChemNet > CAS > 7295-44-5 p-Bromovalerophenone
7295-44-5 p-Bromovalerophenone
| Produkt-Name |
p-Bromovalerophenone |
| Englischer Name |
p-Bromovalerophenone; 4'-bromovalerophenone; 1-(4-Bromophenyl)pentan-1-one; 1-pentanone, 1-(4-bromophenyl)-; p-Bromophenyl butyl ketone |
| Molekulare Formel |
C11H13BrO |
| Molecular Weight |
241.1243 |
| InChI |
InChI=1/C11H13BrO/c1-2-3-4-11(13)9-5-7-10(12)8-6-9/h5-8H,2-4H2,1H3 |
| CAS Registry Number |
7295-44-5 |
| EINECS |
230-729-1 |
| Molecular Structure |
|
| Dichte |
1.291g/cm3 |
| Schmelzpunkt |
34-36℃ |
| Siedepunkt |
291.3°C at 760 mmHg |
| Brechungsindex |
1.532 |
| Flammpunkt |
59.7°C |
| Dampfdruck |
0.00196mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
