ChemNet > CAS > 7423-93-0 3-Chloro-L-tyrosine
7423-93-0 3-Chloro-L-tyrosine
| Produkt-Name |
3-Chloro-L-tyrosine |
| Englischer Name |
3-Chloro-L-tyrosine; 3-Chloro-4-hydroxy-L-phenylalanine~H-Tyr(3-Cl)-OH; 3-chlorotyrosine; H-Tyr(3-Cl)-OH |
| Molekulare Formel |
C9H10ClNO3 |
| Molecular Weight |
215.6336 |
| InChI |
InChI=1/C9H10ClNO3/c10-6-3-5(1-2-8(6)12)4-7(11)9(13)14/h1-3,7,12H,4,11H2,(H,13,14) |
| CAS Registry Number |
7423-93-0 |
| EINECS |
231-050-3 |
| Molecular Structure |
|
| Dichte |
1.458g/cm3 |
| Schmelzpunkt |
249℃ |
| Siedepunkt |
388.6°C at 760 mmHg |
| Brechungsindex |
1.625 |
| Flammpunkt |
188.8°C |
| Dampfdruck |
9.81E-07mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
