ChemNet > CAS > 765-85-5 Cyclobutanecarboxylic acid methyl ester
765-85-5 Cyclobutanecarboxylic acid methyl ester
Produkt-Name |
Cyclobutanecarboxylic acid methyl ester |
Englischer Name |
Cyclobutanecarboxylic acid methyl ester; Methyl cyclobutanecarboxylate |
Molekulare Formel |
C6H10O2 |
Molecular Weight |
114.1424 |
InChI |
InChI=1/C6H10O2/c1-8-6(7)5-3-2-4-5/h5H,2-4H2,1H3 |
CAS Registry Number |
765-85-5 |
Molecular Structure |
|
Dichte |
1.051g/cm3 |
Siedepunkt |
138.7°C at 760 mmHg |
Brechungsindex |
1.453 |
Flammpunkt |
30.1°C |
Dampfdruck |
6.64mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|