77337-82-7 2-Bromo-5-nitroanisole
Produkt-Name |
2-Bromo-5-nitroanisole |
Englischer Name |
2-Bromo-5-nitroanisole; 4-Bromo-3-methoxynitrobenzene; 1-bromo-2-methoxy-4-nitrobenzene |
Molekulare Formel |
C7H6BrNO3 |
Molecular Weight |
232.0314 |
InChI |
InChI=1/C7H6BrNO3/c1-12-7-4-5(9(10)11)2-3-6(7)8/h2-4H,1H3 |
CAS Registry Number |
77337-82-7 |
EINECS |
278-669-5 |
Molecular Structure |
|
Dichte |
1.64g/cm3 |
Schmelzpunkt |
103℃ |
Siedepunkt |
302.1°C at 760 mmHg |
Brechungsindex |
1.581 |
Flammpunkt |
136.5°C |
Dampfdruck |
0.00181mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|