ChemNet > CAS > 78686-87-0 2,5-Dichlorpyridin-3-carbonylchlorid
78686-87-0 2,5-Dichlorpyridin-3-carbonylchlorid
| Produkt-Name |
2,5-Dichlorpyridin-3-carbonylchlorid |
| Englischer Name |
2,5-dichloropyridine-3-carbonyl chloride; |
| Molekulare Formel |
C6H2Cl3NO |
| Molecular Weight |
210.4452 |
| InChI |
InChI=1/C6H2Cl3NO/c7-3-1-4(6(9)11)5(8)10-2-3/h1-2H |
| CAS Registry Number |
78686-87-0 |
| Molecular Structure |
|
| Dichte |
1.582g/cm3 |
| Siedepunkt |
269°C at 760 mmHg |
| Brechungsindex |
1.582 |
| Flammpunkt |
116.5°C |
| Dampfdruck |
0.00745mmHg at 25°C |
| Gefahrensymbole |
 C:Corrosive;
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
