79-15-2 N-bromoacetamide
Produkt-Name |
N-bromoacetamide |
Englischer Name |
N-bromoacetamide;N-Bromoacetamide; CCRIS 4590; Acetamide, N-bromo- |
Molekulare Formel |
C2H4BrNO |
Molecular Weight |
137.9633 |
InChI |
InChI=1/C2H4BrNO/c1-2(5)4-3/h1H3,(H,4,5) |
CAS Registry Number |
79-15-2 |
EINECS |
201-181-0 |
Molecular Structure |
|
Dichte |
1.71g/cm3 |
Brechungsindex |
1.474 |
Gefahrensymbole |
|
Risk Codes |
R34:Causes burns.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|