ChemNet > CAS > 79636-94-5 5-Bromo-2-ethoxybenzaldehyde
79636-94-5 5-Bromo-2-ethoxybenzaldehyde
| Produkt-Name |
5-Bromo-2-ethoxybenzaldehyde |
| Englischer Name |
5-Bromo-2-ethoxybenzaldehyde; |
| Molekulare Formel |
C9H9BrO2 |
| Molecular Weight |
229.0706 |
| InChI |
InChI=1/C9H9BrO2/c1-2-12-9-4-3-8(10)5-7(9)6-11/h3-6H,2H2,1H3 |
| CAS Registry Number |
79636-94-5 |
| Molecular Structure |
|
| Dichte |
1.451g/cm3 |
| Schmelzpunkt |
68℃ |
| Siedepunkt |
302.7°C at 760 mmHg |
| Brechungsindex |
1.573 |
| Flammpunkt |
136.9°C |
| Dampfdruck |
0.000974mmHg at 25°C |
| Gefahrensymbole |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
