ChemNet > CAS > 80789-69-1 1-(4-Chlorophenyl)-1-cyclopentanecarboxylic acid
80789-69-1 1-(4-Chlorophenyl)-1-cyclopentanecarboxylic acid
| Produkt-Name |
1-(4-Chlorophenyl)-1-cyclopentanecarboxylic acid |
| Englischer Name |
1-(4-Chlorophenyl)-1-cyclopentanecarboxylic acid;1-(4-Chlorophenyl)cyclopentanecarboxylic acid; 1-(4-chlorophenyl)cyclopentanecarboxylate |
| Molekulare Formel |
C12H12ClO2 |
| Molecular Weight |
223.676 |
| InChI |
InChI=1/C12H13ClO2/c13-10-5-3-9(4-6-10)12(11(14)15)7-1-2-8-12/h3-6H,1-2,7-8H2,(H,14,15)/p-1 |
| CAS Registry Number |
80789-69-1 |
| EINECS |
279-552-1 |
| Molecular Structure |
|
| Schmelzpunkt |
160-164℃ |
| Siedepunkt |
364.6°C at 760 mmHg |
| Flammpunkt |
174.3°C |
| Dampfdruck |
5.9E-06mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
