ChemNet > CAS > 80866-80-4 2-Chloro-5-nitrobenzyl alcohol
80866-80-4 2-Chloro-5-nitrobenzyl alcohol
| Produkt-Name |
2-Chloro-5-nitrobenzyl alcohol |
| Englischer Name |
2-Chloro-5-nitrobenzyl alcohol;(2-chloro-5-nitrophenyl)methanol |
| Molekulare Formel |
C7H6ClNO3 |
| Molecular Weight |
187.5804 |
| InChI |
InChI=1/C7H6ClNO3/c8-7-2-1-6(9(11)12)3-5(7)4-10/h1-3,10H,4H2 |
| CAS Registry Number |
80866-80-4 |
| EINECS |
279-584-6 |
| Molecular Structure |
|
| Dichte |
1.476g/cm3 |
| Schmelzpunkt |
74-79℃ |
| Siedepunkt |
344.1°C at 760 mmHg |
| Brechungsindex |
1.611 |
| Flammpunkt |
161.9°C |
| Dampfdruck |
2.56E-05mmHg at 25°C |
| Gefahrensymbole |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
