ChemNet > CAS > 81074-81-9 5-(dimethylaminomethyl)furfuryl alcohol hydrochlo
81074-81-9 5-(dimethylaminomethyl)furfuryl alcohol hydrochlo
| Produkt-Name |
5-(dimethylaminomethyl)furfuryl alcohol hydrochlo |
| Englischer Name |
5-(dimethylaminomethyl)furfuryl alcohol hydrochlo; 5-(Dimethylaminomethyl)furfuryl alcohol hydrochloride; {5-[(dimethylamino)methyl]furan-2-yl}methanol hydrochloride |
| Molekulare Formel |
C8H14ClNO2 |
| Molecular Weight |
191.6553 |
| InChI |
InChI=1/C8H13NO2.ClH/c1-9(2)5-7-3-4-8(6-10)11-7;/h3-4,10H,5-6H2,1-2H3;1H |
| CAS Registry Number |
81074-81-9 |
| EINECS |
279-686-0 |
| Molecular Structure |
|
| Schmelzpunkt |
122-125℃ |
| Siedepunkt |
217.7°C at 760 mmHg |
| Flammpunkt |
85.5°C |
| Dampfdruck |
0.0762mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
