ChemNet > CAS > 813-56-9 Malonsäure-d2-Säure-d2
813-56-9 Malonsäure-d2-Säure-d2
| Produkt-Name |
Malonsäure-d2-Säure-d2 |
| Synonyme |
; Malonsäure-d4; (~2~H_2_)Propan(~2~H_2_)Disäure |
| Englischer Name |
Malonic-d2 acid-d2; Malonic acid-d4; (~2~H_2_)propane(~2~H_2_)dioic acid |
| Molekulare Formel |
C3D4O4 |
| Molecular Weight |
108.0861 |
| InChI |
InChI=1/C3H4O4/c4-2(5)1-3(6)7/h1H2,(H,4,5)(H,6,7)/i1D2/hD2 |
| CAS Registry Number |
813-56-9 |
| EINECS |
212-385-4 |
| Molecular Structure |
|
| Dichte |
1.605g/cm3 |
| Schmelzpunkt |
130-132℃ |
| Siedepunkt |
386.8°C at 760 mmHg |
| Brechungsindex |
1.478 |
| Flammpunkt |
201.9°C |
| Dampfdruck |
4.66E-07mmHg at 25°C |
| Gefahrensymbole |
 Xn:Harmful;
|
| Risk Codes |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
