818-88-2 mono-methyl sebacate
Produkt-Name |
mono-methyl sebacate |
Englischer Name |
mono-methyl sebacate; Monomethyl sebacate~Sebacic acid monomethyl ester; Sebacic acid monomethyl ester; Methyl hydrogen sebacate (Monomethyl sebacate; Sebacic acid monomethyl ester); monomethyl sebacate; 10-methoxy-10-oxodecanoic acid |
Molekulare Formel |
C11H20O4 |
Molecular Weight |
216.2741 |
InChI |
InChI=1/C11H20O4/c1-15-11(14)9-7-5-3-2-4-6-8-10(12)13/h2-9H2,1H3,(H,12,13) |
CAS Registry Number |
818-88-2 |
EINECS |
212-458-0 |
Molecular Structure |
|
Dichte |
1.038g/cm3 |
Schmelzpunkt |
41-44℃ |
Siedepunkt |
332.5°C at 760 mmHg |
Brechungsindex |
1.453 |
Flammpunkt |
115.4°C |
Dampfdruck |
2.8E-05mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|