82-22-4 1,1'-Dianthrimid
Produkt-Name |
1,1'-Dianthrimid |
Synonyme |
; 1,1-Iminodianthrachinon; 1,1'-Iminodianthracen-9,10-dion |
Englischer Name |
1,1'-dianthrimide; 1,1-iminodianthraquinone; 1,1'-iminodianthracene-9,10-dione |
Molekulare Formel |
C28H15NO4 |
Molecular Weight |
429.423 |
InChI |
InChI=1/C28H15NO4/c30-25-15-7-1-3-9-17(15)27(32)23-19(25)11-5-13-21(23)29-22-14-6-12-20-24(22)28(33)18-10-4-2-8-16(18)26(20)31/h1-14,29H |
CAS Registry Number |
82-22-4 |
EINECS |
201-405-7 |
Molecular Structure |
|
Dichte |
1.456g/cm3 |
Schmelzpunkt |
300℃ |
Siedepunkt |
667.1°C at 760 mmHg |
Brechungsindex |
1.753 |
Flammpunkt |
221.6°C |
Dampfdruck |
1.17E-17mmHg at 25°C |
Gefahrensymbole |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|