827-15-6 iodopentafluorobenzene
Produkt-Name |
iodopentafluorobenzene |
Englischer Name |
iodopentafluorobenzene; Pentafluoroiodobenzene; 1,2,3,4,5-pentafluoro-6-iodo-benzene; 1-Iodo-2,3,4,5,6-Pentafluorobenzene |
Molekulare Formel |
C6F5I |
Molecular Weight |
293.9607 |
InChI |
InChI=1/C6F5I/c7-1-2(8)4(10)6(12)5(11)3(1)9 |
CAS Registry Number |
827-15-6 |
EINECS |
212-565-2 |
Molecular Structure |
|
Dichte |
2.217g/cm3 |
Siedepunkt |
166.7°C at 760 mmHg |
Brechungsindex |
1.502 |
Flammpunkt |
61.3°C |
Dampfdruck |
2.33mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|