ChemNet > CAS > 82894-98-2 4-(4-Nitrophenyl)-1,2,3-thiadiazole
82894-98-2 4-(4-Nitrophenyl)-1,2,3-thiadiazole
Produkt-Name |
4-(4-Nitrophenyl)-1,2,3-thiadiazole |
Englischer Name |
4-(4-Nitrophenyl)-1,2,3-thiadiazole; |
Molekulare Formel |
C8H5N3O2S |
Molecular Weight |
207.2092 |
InChI |
InChI=1/C8H5N3O2S/c12-11(13)7-3-1-6(2-4-7)8-5-14-10-9-8/h1-5H |
CAS Registry Number |
82894-98-2 |
Molecular Structure |
|
Dichte |
1.454g/cm3 |
Schmelzpunkt |
208-210℃ |
Siedepunkt |
378.3°C at 760 mmHg |
Brechungsindex |
1.649 |
Flammpunkt |
182.6°C |
Dampfdruck |
1.39E-05mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|