83014-44-2 quin 2
Produkt-Name |
quin 2 |
Englischer Name |
quin 2; Quin-2, free acid; Quin-2; {[2-({8-[bis(carboxymethyl)amino]-6-methoxyquinolin-2-yl}methoxy)-4-methylphenyl](carboxymethyl)amino}acetic acid |
Molekulare Formel |
C26H27N3O10 |
Molecular Weight |
541.5067 |
InChI |
InChI=1/C26H27N3O10/c1-15-3-6-19(28(10-22(30)31)11-23(32)33)21(7-15)39-14-17-5-4-16-8-18(38-2)9-20(26(16)27-17)29(12-24(34)35)13-25(36)37/h3-9H,10-14H2,1-2H3,(H,30,31)(H,32,33)(H,34,35)(H,36,37) |
CAS Registry Number |
83014-44-2 |
Molecular Structure |
|
Dichte |
1.494g/cm3 |
Schmelzpunkt |
164-166℃ |
Siedepunkt |
831.6°C at 760 mmHg |
Brechungsindex |
1.688 |
Flammpunkt |
456.7°C |
Dampfdruck |
2.58E-29mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|