ChemNet > CAS > 83463-62-1 Bromochloroacetonitrile
83463-62-1 Bromochloroacetonitrile
| Produkt-Name |
Bromochloroacetonitrile |
| Englischer Name |
Bromochloroacetonitrile;Bromochloromethyl cyanide; CCRIS 2672; HSDB 7617; Acetonitrile, bromochloro- |
| Molekulare Formel |
C2HBrClN |
| Molecular Weight |
154.393 |
| InChI |
InChI=1/C2HBrClN/c3-2(4)1-5/h2H |
| CAS Registry Number |
83463-62-1 |
| Molecular Structure |
|
| Dichte |
1.932g/cm3 |
| Siedepunkt |
121.1°C at 760 mmHg |
| Brechungsindex |
1.506 |
| Flammpunkt |
27.1°C |
| Dampfdruck |
14.8mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R34:Causes burns.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
