86-79-3 2-Hydroxycarbazole
Produkt-Name |
2-Hydroxycarbazole |
Englischer Name |
2-Hydroxycarbazole; carbazol-2-ol; 9H-carbazol-2-ol; 2-Hydroxy-9H-carbazole |
Molekulare Formel |
C12H9NO |
Molecular Weight |
183.206 |
InChI |
InChI=1/C12H9NO/c14-8-5-6-10-9-3-1-2-4-11(9)13-12(10)7-8/h1-7,13-14H |
CAS Registry Number |
86-79-3 |
EINECS |
201-699-7 |
Molecular Structure |
|
Dichte |
1.362g/cm3 |
Schmelzpunkt |
273-275℃ |
Siedepunkt |
431.4°C at 760 mmHg |
Brechungsindex |
1.815 |
Flammpunkt |
214.7°C |
Dampfdruck |
4.78E-08mmHg at 25°C |
Gefahrensymbole |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|