87-05-8 7-Ethoxy-4-methylcoumarin
Produkt-Name |
7-Ethoxy-4-methylcoumarin |
Englischer Name |
7-Ethoxy-4-methylcoumarin;7-Ethoxy-4-methyl-2H-chromen-2-one; Ethyl 4-methylumbelliferyl ether |
Molekulare Formel |
C12H12O3 |
Molecular Weight |
204.2219 |
InChI |
InChI=1/C12H12O3/c1-3-14-9-4-5-10-8(2)6-12(13)15-11(10)7-9/h4-7H,3H2,1-2H3 |
CAS Registry Number |
87-05-8 |
EINECS |
201-721-5 |
Molecular Structure |
|
Dichte |
1.163g/cm3 |
Schmelzpunkt |
113-114℃ |
Siedepunkt |
351.4°C at 760 mmHg |
Brechungsindex |
1.548 |
Flammpunkt |
146.2°C |
Dampfdruck |
4.12E-05mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|