ChemNet > CAS > 87327-69-3 2-Chloro-6-fluoroacetophenone
87327-69-3 2-Chloro-6-fluoroacetophenone
| Produkt-Name |
2-Chloro-6-fluoroacetophenone |
| Englischer Name |
2-Chloro-6-fluoroacetophenone;1-(2-chloro-6-fluorophenyl)ethanone; 2'-Chloro-6'-fluoroacetophenone |
| Molekulare Formel |
C8H6ClFO |
| Molecular Weight |
172.584 |
| InChI |
InChI=1/C8H6ClFO/c1-5(11)8-6(9)3-2-4-7(8)10/h2-4H,1H3 |
| CAS Registry Number |
87327-69-3 |
| Molecular Structure |
|
| Dichte |
1.258g/cm3 |
| Siedepunkt |
191.8°C at 760 mmHg |
| Brechungsindex |
1.512 |
| Flammpunkt |
69.8°C |
| Dampfdruck |
0.506mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
R36/38:Irritating to eyes and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
