878-00-2 4-Acetoxybenzaldehyde
Produkt-Name |
4-Acetoxybenzaldehyde |
Englischer Name |
4-Acetoxybenzaldehyde; 4-Formylphenyl acetate |
Molekulare Formel |
C9H8O3 |
Molecular Weight |
164.158 |
InChI |
InChI=1/C9H8O3/c1-7(11)12-9-4-2-8(6-10)3-5-9/h2-6H,1H3 |
CAS Registry Number |
878-00-2 |
EINECS |
212-898-3 |
Molecular Structure |
|
Dichte |
1.183g/cm3 |
Siedepunkt |
275°C at 760 mmHg |
Brechungsindex |
1.552 |
Flammpunkt |
119.4°C |
Dampfdruck |
0.00522mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
R36/38:Irritating to eyes and skin.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|