881-68-5 acetyl vanillin
Produkt-Name |
acetyl vanillin |
Englischer Name |
acetyl vanillin; Vanillin acetate; 4-formyl-2-methoxyphenyl acetate; 4-Acetoxy-3-methoxybenzaidehyde; o-Acetylvanillin; 4-Acetoxy-3-methoxybenzaldehyde |
Molekulare Formel |
C10H10O4 |
Molecular Weight |
194.184 |
InChI |
InChI=1/C10H10O4/c1-6(12)9-7(5-11)3-4-8(13)10(9)14-2/h3-5,13H,1-2H3 |
CAS Registry Number |
881-68-5 |
EINECS |
212-920-1 |
Molecular Structure |
|
Schmelzpunkt |
77-79℃ |
Brechungsindex |
1.579 |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|