886-66-8 1,4-Diphenylbutadiyne
Produkt-Name |
1,4-Diphenylbutadiyne |
Englischer Name |
1,4-Diphenylbutadiyne; |
Molekulare Formel |
C16H10 |
Molecular Weight |
202.2506 |
InChI |
InChI=1/C16H10/c1-3-9-15(10-4-1)13-7-8-14-16-11-5-2-6-12-16/h1-6,9-12H |
CAS Registry Number |
886-66-8 |
EINECS |
212-953-1 |
Molecular Structure |
|
Dichte |
1.1g/cm3 |
Schmelzpunkt |
85-88℃ |
Siedepunkt |
338.2°C at 760 mmHg |
Brechungsindex |
1.642 |
Flammpunkt |
150.5°C |
Dampfdruck |
0.000196mmHg at 25°C |
Gefahrensymbole |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|