ChemNet > CAS > 89250-34-0 3-(2-methyl-1,3-thiazol-4-yl)aniline
89250-34-0 3-(2-methyl-1,3-thiazol-4-yl)aniline
| Produkt-Name |
3-(2-methyl-1,3-thiazol-4-yl)aniline |
| Englischer Name |
3-(2-methyl-1,3-thiazol-4-yl)aniline; |
| Molekulare Formel |
C10H10N2S |
| Molecular Weight |
190.2648 |
| InChI |
InChI=1/C10H10N2S/c1-7-12-10(6-13-7)8-3-2-4-9(11)5-8/h2-6H,11H2,1H3 |
| CAS Registry Number |
89250-34-0 |
| Molecular Structure |
|
| Dichte |
1.219g/cm3 |
| Siedepunkt |
380.6°C at 760 mmHg |
| Brechungsindex |
1.642 |
| Flammpunkt |
184°C |
| Dampfdruck |
5.37E-06mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
