ChemNet > CAS > 90-11-9 1-Bromonaphthalene
90-11-9 1-Bromonaphthalene
| Produkt-Name |
1-Bromonaphthalene |
| Englischer Name |
1-Bromonaphthalene; 1-bromo-naphthalen; 1-naphthyl bromide; 1-naphthylbromide; i-bromnaphthalin; naphthalene,1-bromo-; α-bromonaphthalene; a-bromonaphthalene; 1-bromo napthalene; 1-bromonaphtalene; 1-Bremnaphthalene |
| Molekulare Formel |
C10H7Br |
| Molecular Weight |
207.0666 |
| InChI |
InChI=1/C10H7Br/c11-10-7-3-5-8-4-1-2-6-9(8)10/h1-7H |
| CAS Registry Number |
90-11-9 |
| EINECS |
201-965-2 |
| Molecular Structure |
|
| Dichte |
1.481g/cm3 |
| Schmelzpunkt |
-1℃ |
| Siedepunkt |
282.7°C at 760 mmHg |
| Brechungsindex |
1.663 |
| Flammpunkt |
127.8°C |
| Wasserlöslichkeit |
slightly soluble |
| Dampfdruck |
0.00565mmHg at 25°C |
| Gefahrensymbole |
 Xn:Harmful;
|
| Risk Codes |
R22:;
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
