90-90-4 4-Bromobenzophenone
Produkt-Name |
4-Bromobenzophenone |
Englischer Name |
4-Bromobenzophenone;Benzophenone, 4-bromo-; 4-07-00-01378 (Beilstein Handbook Reference); 4-Bromophenyl phenyl ketone; BRN 1910182; NSC 59863; USAF DO-3; p-Benzoylbromobenzene; p-Bromobenzophenone; Methanone, (4-bromophenyl)phenyl-; Methanone, (4-bromophenyl)phenyl- (9CI); (4-bromophenyl)(phenyl)methanone |
Molekulare Formel |
C13H9BrO |
Molecular Weight |
261.114 |
InChI |
InChI=1/C13H9BrO/c14-12-8-6-11(7-9-12)13(15)10-4-2-1-3-5-10/h1-9H |
CAS Registry Number |
90-90-4 |
EINECS |
202-024-9 |
Molecular Structure |
|
Dichte |
1.421g/cm3 |
Schmelzpunkt |
78-82℃ |
Siedepunkt |
346.8°C at 760 mmHg |
Brechungsindex |
1.61 |
Flammpunkt |
81.3°C |
Dampfdruck |
5.62E-05mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|