ChemNet > CAS > 9002-83-9 poly(chlorotrifluoroethylene)
9002-83-9 poly(chlorotrifluoroethylene)
| Produkt-Name |
poly(chlorotrifluoroethylene) |
| Englischer Name |
poly(chlorotrifluoroethylene); halocarbon oil 27 insect cell*culture tested; Fluorolube grease; PCTFE; Fluorolube Grease, Gr-362 |
| Molekulare Formel |
C2ClF3 |
| Molecular Weight |
116.4693 |
| InChI |
InChI=1/C2ClF3/c3-1(4)2(5)6 |
| CAS Registry Number |
9002-83-9 |
| Molecular Structure |
|
| Dichte |
1.9 |
| Schmelzpunkt |
210℃ |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
