Produkt-Name |
4-Methyl-3,4-dihydro-2H-1,4-benzoxazin-7-carbonsäure |
Synonyme |
3,4-Dihydro-2H-1,4-benzoxazin-2-carbonsäure; (2S)-3,4-Dihydro-2H-1,4-benzoxazin-2-carboxylat; (2R)-3,4-Dihydro-2H-1,4-benzoxazin-2-carboxylat |
Englischer Name |
4-methyl-3,4-dihydro-2H-1,4-benzoxazine-7-carboxylic acid;3,4-dihydro-2H-1,4-benzoxazine-2-carboxylic acid; (2S)-3,4-dihydro-2H-1,4-benzoxazine-2-carboxylate; (2R)-3,4-dihydro-2H-1,4-benzoxazine-2-carboxylate |
Molekulare Formel |
C9H8NO3 |
Molecular Weight |
178.1653 |
InChI |
InChI=1/C9H9NO3/c11-9(12)8-5-10-6-3-1-2-4-7(6)13-8/h1-4,8,10H,5H2,(H,11,12)/p-1/t8-/m1/s1 |
CAS Registry Number |
90563-93-2 |
Molecular Structure |
|
Siedepunkt |
399.7°C at 760 mmHg |
Flammpunkt |
195.6°C |
Dampfdruck |
4.16E-07mmHg at 25°C |
Gefahrensymbole |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|