ChemNet > CAS > 90567-39-8 3-(Hydroxymethyl)-5-(methylthio)-1,3,4-thiadiazol-2(3H)-thion
90567-39-8 3-(Hydroxymethyl)-5-(methylthio)-1,3,4-thiadiazol-2(3H)-thion
| Produkt-Name |
3-(Hydroxymethyl)-5-(methylthio)-1,3,4-thiadiazol-2(3H)-thion |
| Synonyme |
3-(Hydroxymethyl)-5-(methylsulfanyl)-1,3,4-thiadiazol-2(3H)-thion |
| Englischer Name |
3-(hydroxymethyl)-5-(methylthio)-1,3,4-thiadiazole-2(3H)-thione;3-(hydroxymethyl)-5-(methylsulfanyl)-1,3,4-thiadiazole-2(3H)-thione |
| Molekulare Formel |
C4H6N2OS3 |
| Molecular Weight |
194.2982 |
| InChI |
InChI=1/C4H6N2OS3/c1-9-3-5-6(2-7)4(8)10-3/h7H,2H2,1H3 |
| CAS Registry Number |
90567-39-8 |
| Molecular Structure |
|
| Dichte |
1.64g/cm3 |
| Schmelzpunkt |
72℃ |
| Siedepunkt |
306.9°C at 760 mmHg |
| Brechungsindex |
1.771 |
| Flammpunkt |
139.4°C |
| Dampfdruck |
6.94E-05mmHg at 25°C |
| Gefahrensymbole |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
