ChemNet > CAS > 934-48-5 3,5-Dimethylpyrazole-1-carboxamide
934-48-5 3,5-Dimethylpyrazole-1-carboxamide
Produkt-Name |
3,5-Dimethylpyrazole-1-carboxamide |
Englischer Name |
3,5-Dimethylpyrazole-1-carboxamide; 1-Carboxamido-3,5-dimethylpyrazole; 3,5-Dimethyl-1H-pyrazole-1-carboxamide |
Molekulare Formel |
C6H9N3O |
Molecular Weight |
139.1552 |
InChI |
InChI=1/C6H9N3O/c1-4-3-5(2)9(8-4)6(7)10/h3H,1-2H3,(H2,7,10) |
CAS Registry Number |
934-48-5 |
EINECS |
213-283-2 |
Molecular Structure |
|
Dichte |
1.28g/cm3 |
Schmelzpunkt |
110-113℃ |
Siedepunkt |
296.8°C at 760 mmHg |
Brechungsindex |
1.6 |
Flammpunkt |
133.3°C |
Dampfdruck |
0.0014mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|