935-69-3 7-Methyladenine
Produkt-Name |
7-Methyladenine |
Englischer Name |
7-Methyladenine; 6-Amino-7-methylpurine; 7-methyl-7H-purin-6-amine |
Molekulare Formel |
C6H7N5 |
Molecular Weight |
149.1533 |
InChI |
InChI=1/C6H7N5/c1-11-3-10-6-4(11)5(7)8-2-9-6/h2-3H,1H3,(H2,7,8,9) |
CAS Registry Number |
935-69-3 |
Molecular Structure |
|
Dichte |
1.6g/cm3 |
Schmelzpunkt |
323℃ |
Siedepunkt |
385.9°C at 760 mmHg |
Brechungsindex |
1.807 |
Flammpunkt |
187.2°C |
Dampfdruck |
3.67E-06mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|