943-15-7 2-Nitro-4-cymene
Produkt-Name |
2-Nitro-4-cymene |
Englischer Name |
2-Nitro-4-cymene; 2-nitro-para-cymene; 1-methyl-2-nitro-4-(propan-2-yl)benzene; 2-Nitro-p-cymene; 2-nitro-4-isopropyltoluene; 4-Isopropyl-2-nitrotoluene |
Molekulare Formel |
C10H13NO2 |
Molecular Weight |
179.2157 |
InChI |
InChI=1/C10H13NO2/c1-7(2)9-5-4-8(3)10(6-9)11(12)13/h4-7H,1-3H3 |
CAS Registry Number |
943-15-7 |
EINECS |
213-397-2 |
Molecular Structure |
|
Dichte |
1.069g/cm3 |
Siedepunkt |
241.7°C at 760 mmHg |
Brechungsindex |
1.53 |
Flammpunkt |
90.2°C |
Dampfdruck |
0.055mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|