95-26-1 2,5-Dimethylbenzothiazole
Produkt-Name |
2,5-Dimethylbenzothiazole |
Englischer Name |
2,5-Dimethylbenzothiazole;Benzothiazole, 2,5-dimethyl-; 2,5-Dimethylbenzthiazol; 2,5-Dimethylbenzthiazol [Czech]; 4-27-00-01101 (Beilstein Handbook Reference); BRN 0116455; 2,5-dimethyl-1,3-benzothiazole |
Molekulare Formel |
C9H9NS |
Molecular Weight |
163.2395 |
InChI |
InChI=1/C9H9NS/c1-6-3-4-9-8(5-6)10-7(2)11-9/h3-5H,1-2H3 |
CAS Registry Number |
95-26-1 |
EINECS |
202-404-4 |
Molecular Structure |
|
Dichte |
1.176g/cm3 |
Schmelzpunkt |
36-40℃ |
Siedepunkt |
259.4°C at 760 mmHg |
Brechungsindex |
1.643 |
Flammpunkt |
112.7°C |
Dampfdruck |
0.021mmHg at 25°C |
Gefahrensymbole |
Xn:Harmful;
|
Risk Codes |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Beschreibung |
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|