951-55-3 5-Methyl-DL-tryptophan
Produkt-Name |
5-Methyl-DL-tryptophan |
Englischer Name |
5-Methyl-DL-tryptophan; |
Molekulare Formel |
C12H14N2O2 |
Molecular Weight |
218.2518 |
InChI |
InChI=1/C12H14N2O2/c1-7-2-3-11-9(4-7)8(6-14-11)5-10(13)12(15)16/h2-4,6,10,14H,5,13H2,1H3,(H,15,16)/t10-/m1/s1 |
CAS Registry Number |
951-55-3 |
EINECS |
213-453-6 |
Molecular Structure |
|
Dichte |
1.313g/cm3 |
Schmelzpunkt |
280-282℃ |
Siedepunkt |
455.1°C at 760 mmHg |
Brechungsindex |
1.677 |
Flammpunkt |
229.1°C |
Dampfdruck |
4.48E-09mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|