ChemNet > CAS > 952-97-6 4-Nitrophenyl phenyl sulfide
952-97-6 4-Nitrophenyl phenyl sulfide
Produkt-Name |
4-Nitrophenyl phenyl sulfide |
Englischer Name |
4-Nitrophenyl phenyl sulfide; 4-Nitrodiphenyl Sulfide; 1-nitro-4-(phenylsulfanyl)benzene |
Molekulare Formel |
C12H9NO2S |
Molecular Weight |
231.2704 |
InChI |
InChI=1/C12H9NO2S/c14-13(15)10-6-8-12(9-7-10)16-11-4-2-1-3-5-11/h1-9H |
CAS Registry Number |
952-97-6 |
EINECS |
213-462-5 |
Molecular Structure |
|
Dichte |
1.31g/cm3 |
Schmelzpunkt |
54-58℃ |
Siedepunkt |
396.8°C at 760 mmHg |
Brechungsindex |
1.665 |
Flammpunkt |
193.8°C |
Dampfdruck |
3.8E-06mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|